C22H21O6S- — CID 123811543
4-[2-(4-butan-2-ylphenoxy)acetyl]oxynaphthalene-1-sulfonate (PubChem CID 123811543) has the molecular formula C22H21O6S- and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-[2-(4-butan-2-ylphenoxy)acetyl]oxynaphthalene-1-sulfonate.
| Compound Name | 4-[2-(4-butan-2-ylphenoxy)acetyl]oxynaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 123811543 |
| Molecular Formula | C22H21O6S- |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[2-(4-butan-2-ylphenoxy)acetyl]oxynaphthalene-1-sulfonate |
| SMILES | CCC(C)c1ccc(OCC(=O)Oc2ccc(S(=O)(=O)[O-])c3ccccc23)cc1 |
| InChI | InChI=1S/C22H22O6S/c1-3-15(2)16-8-10-17(11-9-16)27-14-22(23)28-20-12-13-21(29(24,25)26)19-7-5-4-6-18(19)20/h4-13,15H,3,14H2,1-2H3,(H,24,25,26)/p-1 |
| InChIKey | LJVOCULULJBVBS-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|