About (2-ethoxyphenyl) 2-methylbutanoate
(2-ethoxyphenyl) 2-methylbutanoate (PubChem CID 118040361) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (2-ethoxyphenyl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (2-ethoxyphenyl) 2-methylbutanoate |
| PubChem CID | 118040361 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2-ethoxyphenyl) 2-methylbutanoate |
| SMILES | CCOc1ccccc1OC(=O)C(C)CC |
| InChI | InChI=1S/C13H18O3/c1-4-10(3)13(14)16-12-9-7-6-8-11(12)15-5-2/h6-10H,4-5H2,1-3H3 |
| InChIKey | WBPHNCCFVOZCHR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxyphenyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxyphenyl) 2-methylbutanoate?
The IUPAC name of (2-ethoxyphenyl) 2-methylbutanoate (CID 118040361) is (2-ethoxyphenyl) 2-methylbutanoate.
What is the SMILES notation for (2-ethoxyphenyl) 2-methylbutanoate?
The canonical SMILES for (2-ethoxyphenyl) 2-methylbutanoate is CCOc1ccccc1OC(=O)C(C)CC.
What is the InChIKey of (2-ethoxyphenyl) 2-methylbutanoate?
The InChIKey is WBPHNCCFVOZCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-10(3)13(14)16-12-9-7-6-8-11(12)15-5-2/h6-10H,4-5H2,1-3H3.
What are the key properties of (2-ethoxyphenyl) 2-methylbutanoate?
(2-ethoxyphenyl) 2-methylbutanoate has a molecular weight of 222.28 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl) 2-methylbutanoate is sourced from PubChem (CID 118040361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).