About (10-bromoanthracen-9-yl) 2-methylbutanoate
(10-bromoanthracen-9-yl) 2-methylbutanoate (PubChem CID 58341696) has the molecular formula C19H17BrO2
and a molecular weight of 357.25 g/mol. Its IUPAC name is (10-bromoanthracen-9-yl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (10-bromoanthracen-9-yl) 2-methylbutanoate |
| PubChem CID | 58341696 |
| Molecular Formula | C19H17BrO2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (10-bromoanthracen-9-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1c2ccccc2c(Br)c2ccccc12 |
| InChI | InChI=1S/C19H17BrO2/c1-3-12(2)19(21)22-18-15-10-6-4-8-13(15)17(20)14-9-5-7-11-16(14)18/h4-12H,3H2,1-2H3 |
| InChIKey | CILKDHLGOQICMN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (10-bromoanthracen-9-yl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-bromoanthracen-9-yl) 2-methylbutanoate?
The IUPAC name of (10-bromoanthracen-9-yl) 2-methylbutanoate (CID 58341696) is (10-bromoanthracen-9-yl) 2-methylbutanoate.
What is the SMILES notation for (10-bromoanthracen-9-yl) 2-methylbutanoate?
The canonical SMILES for (10-bromoanthracen-9-yl) 2-methylbutanoate is CCC(C)C(=O)Oc1c2ccccc2c(Br)c2ccccc12.
What is the InChIKey of (10-bromoanthracen-9-yl) 2-methylbutanoate?
The InChIKey is CILKDHLGOQICMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrO2/c1-3-12(2)19(21)22-18-15-10-6-4-8-13(15)17(20)14-9-5-7-11-16(14)18/h4-12H,3H2,1-2H3.
What are the key properties of (10-bromoanthracen-9-yl) 2-methylbutanoate?
(10-bromoanthracen-9-yl) 2-methylbutanoate has a molecular weight of 357.25 g/mol, XLogP of 5.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10-bromoanthracen-9-yl) 2-methylbutanoate is sourced from PubChem (CID 58341696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).