(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate

C19H18O4 — CID 58391901

IUPAC(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate
SMILESCCC(C)C(=O)Oc1c2ccccc2c(O)c2cc(O)ccc12
InChIInChI=1S/C19H18O4/c1-3-11(2)19(22)23-18-14-7-5-4-6-13(14)17(21)16-10-12(20)8-9-15(16)18/h4-11,20-21H,3H2,1-2H3
InChIKeySCXYGIZGUOJLRD-UHFFFAOYSA-N
MW310.35 g/mol
LogP4.36
Rot. Bonds3

About (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate

(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate (PubChem CID 58391901) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate.

Molecular Properties

Compound Name(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate
PubChem CID58391901
Molecular FormulaC19H18O4
Molecular Weight310.35 g/mol
Exact Mass310.12
IUPAC Name(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate
SMILESCCC(C)C(=O)Oc1c2ccccc2c(O)c2cc(O)ccc12
InChIInChI=1S/C19H18O4/c1-3-11(2)19(22)23-18-14-7-5-4-6-13(14)17(21)16-10-12(20)8-9-15(16)18/h4-11,20-21H,3H2,1-2H3
InChIKeySCXYGIZGUOJLRD-UHFFFAOYSA-N
XLogP4.36
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.35
LogP ≤ 54.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate?
The IUPAC name of (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate (CID 58391901) is (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate.
What is the SMILES notation for (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate?
The canonical SMILES for (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate is CCC(C)C(=O)Oc1c2ccccc2c(O)c2cc(O)ccc12.
What is the InChIKey of (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate?
The InChIKey is SCXYGIZGUOJLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-3-11(2)19(22)23-18-14-7-5-4-6-13(14)17(21)16-10-12(20)8-9-15(16)18/h4-11,20-21H,3H2,1-2H3.
What are the key properties of (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate?
(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate has a molecular weight of 310.35 g/mol, XLogP of 4.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate is sourced from PubChem (CID 58391901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).