C19H18O4 — CID 58391901
(3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate (PubChem CID 58391901) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate.
| Compound Name | (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 58391901 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (3,10-dihydroxyanthracen-9-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1c2ccccc2c(O)c2cc(O)ccc12 |
| InChI | InChI=1S/C19H18O4/c1-3-11(2)19(22)23-18-14-7-5-4-6-13(14)17(21)16-10-12(20)8-9-15(16)18/h4-11,20-21H,3H2,1-2H3 |
| InChIKey | SCXYGIZGUOJLRD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|