About (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate
(10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate (PubChem CID 153455253) has the molecular formula C21H20O4
and a molecular weight of 336.39 g/mol. Its IUPAC name is (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate.
Molecular Properties
| Compound Name | (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate |
| PubChem CID | 153455253 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate |
| SMILES | COc1c2ccccc2c(OC(=O)C(C)CC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C21H20O4/c1-13(12-14(2)22)21(23)25-20-17-10-6-4-8-15(17)19(24-3)16-9-5-7-11-18(16)20/h4-11,13H,12H2,1-3H3 |
| InChIKey | YXXHDIPNJRETDP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate?
The IUPAC name of (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate (CID 153455253) is (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate.
What is the SMILES notation for (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate?
The canonical SMILES for (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate is COc1c2ccccc2c(OC(=O)C(C)CC(C)=O)c2ccccc12.
What is the InChIKey of (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate?
The InChIKey is YXXHDIPNJRETDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O4/c1-13(12-14(2)22)21(23)25-20-17-10-6-4-8-15(17)19(24-3)16-9-5-7-11-18(16)20/h4-11,13H,12H2,1-3H3.
What are the key properties of (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate?
(10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate has a molecular weight of 336.39 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (10-methoxyanthracen-9-yl) 2-methyl-4-oxopentanoate is sourced from PubChem (CID 153455253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).