C27H34N2O4 — CID 153455280
(10-methoxyanthracen-9-yl) N-(6-acetamido-2,4,4-trimethylhexyl)carbamate (PubChem CID 153455280) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is (10-methoxyanthracen-9-yl) N-(6-acetamido-2,4,4-trimethylhexyl)carbamate.
| Compound Name | (10-methoxyanthracen-9-yl) N-(6-acetamido-2,4,4-trimethylhexyl)carbamate |
|---|---|
| PubChem CID | 153455280 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (10-methoxyanthracen-9-yl) N-(6-acetamido-2,4,4-trimethylhexyl)carbamate |
| SMILES | COc1c2ccccc2c(OC(=O)NCC(C)CC(C)(C)CCNC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C27H34N2O4/c1-18(16-27(3,4)14-15-28-19(2)30)17-29-26(31)33-25-22-12-8-6-10-20(22)24(32-5)21-11-7-9-13-23(21)25/h6-13,18H,14-17H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | HYOHUKRVJFVSRV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|