C20H36N4O7 — CID 118934885
2-[[2-[[6-[[2-(2-methoxyethylamino)-2-oxoacetyl]amino]-2,4,4-trimethylhexyl]amino]-2-oxoacetyl]amino]ethyl acetate (PubChem CID 118934885) has the molecular formula C20H36N4O7 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[[2-[[6-[[2-(2-methoxyethylamino)-2-oxoacetyl]amino]-2,4,4-trimethylhexyl]amino]-2-oxoacetyl]amino]ethyl acetate.
| Compound Name | 2-[[2-[[6-[[2-(2-methoxyethylamino)-2-oxoacetyl]amino]-2,4,4-trimethylhexyl]amino]-2-oxoacetyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 118934885 |
| Molecular Formula | C20H36N4O7 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[[2-[[6-[[2-(2-methoxyethylamino)-2-oxoacetyl]amino]-2,4,4-trimethylhexyl]amino]-2-oxoacetyl]amino]ethyl acetate |
| SMILES | COCCNC(=O)C(=O)NCCC(C)(C)CC(C)CNC(=O)C(=O)NCCOC(C)=O |
| InChI | InChI=1S/C20H36N4O7/c1-14(13-24-19(29)18(28)23-9-11-31-15(2)25)12-20(3,4)6-7-21-16(26)17(27)22-8-10-30-5/h14H,6-13H2,1-5H3,(H,21,26)(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | CYLUPLYUIAIGSC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|