C13H24N4O4 — CID 3379681
3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]-N-(2-methylpropyl)but-3-enamide (PubChem CID 3379681) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]-N-(2-methylpropyl)but-3-enamide.
| Compound Name | 3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]-N-(2-methylpropyl)but-3-enamide |
|---|---|
| PubChem CID | 3379681 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]-N-(2-methylpropyl)but-3-enamide |
| SMILES | C=C(CC(=O)NCC(C)C)NNC(=O)C(=O)NCCOC |
| InChI | InChI=1S/C13H24N4O4/c1-9(2)8-15-11(18)7-10(3)16-17-13(20)12(19)14-5-6-21-4/h9,16H,3,5-8H2,1-2,4H3,(H,14,19)(H,15,18)(H,17,20) |
| InChIKey | PMAAYGLJKXPANJ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|