C13H26N2O3 — CID 108505035
N-(2-methoxyethyl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108505035) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(2-methoxyethyl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108505035 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-(2-methoxyethyl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | COCCNC(=O)C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-10(2)8-15(9-11(3)4)13(17)12(16)14-6-7-18-5/h10-11H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | ITSKISJAZXFLLL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|