About N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide
N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide (PubChem CID 43316288) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide |
| PubChem CID | 43316288 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide |
| SMILES | CCN(CC(C)C)C(=O)C(=O)NCC#N |
| InChI | InChI=1S/C10H17N3O2/c1-4-13(7-8(2)3)10(15)9(14)12-6-5-11/h8H,4,6-7H2,1-3H3,(H,12,14) |
| InChIKey | VNHDMJWLCCQWDG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide?
The IUPAC name of N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide (CID 43316288) is N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide?
The canonical SMILES for N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide is CCN(CC(C)C)C(=O)C(=O)NCC#N.
What is the InChIKey of N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide?
The InChIKey is VNHDMJWLCCQWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-4-13(7-8(2)3)10(15)9(14)12-6-5-11/h8H,4,6-7H2,1-3H3,(H,12,14).
What are the key properties of N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide?
N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide has a molecular weight of 211.26 g/mol, XLogP of 0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-ethyl-N'-(2-methylpropyl)oxamide is sourced from PubChem (CID 43316288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).