C8H16N2O3 — CID 108526072
N',N'-diethyl-N-(2-hydroxyethyl)oxamide (PubChem CID 108526072) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-hydroxyethyl)oxamide.
| Compound Name | N',N'-diethyl-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108526072 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | N',N'-diethyl-N-(2-hydroxyethyl)oxamide |
| SMILES | CCN(CC)C(=O)C(=O)NCCO |
| InChI | InChI=1S/C8H16N2O3/c1-3-10(4-2)8(13)7(12)9-5-6-11/h11H,3-6H2,1-2H3,(H,9,12) |
| InChIKey | UIYFBWIJBVPUQC-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|