About N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide
N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide (PubChem CID 43316467) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide |
| PubChem CID | 43316467 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide |
| SMILES | CCCN(CC)C(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C9H17N3O2S/c1-3-5-12(4-2)9(14)8(13)11-6-7(10)15/h3-6H2,1-2H3,(H2,10,15)(H,11,13) |
| InChIKey | PZRYOROWQYPJRK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide?
The IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide (CID 43316467) is N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide.
What is the SMILES notation for N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide?
The canonical SMILES for N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide is CCCN(CC)C(=O)C(=O)NCC(N)=S.
What is the InChIKey of N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide?
The InChIKey is PZRYOROWQYPJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-3-5-12(4-2)9(14)8(13)11-6-7(10)15/h3-6H2,1-2H3,(H2,10,15)(H,11,13).
What are the key properties of N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide?
N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide has a molecular weight of 231.32 g/mol, XLogP of -0.35, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide is sourced from PubChem (CID 43316467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).