C9H17N3O2S — CID 43316467
N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide (PubChem CID 43316467) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide |
|---|---|
| PubChem CID | 43316467 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-ethyl-N'-propyloxamide |
| SMILES | CCCN(CC)C(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C9H17N3O2S/c1-3-5-12(4-2)9(14)8(13)11-6-7(10)15/h3-6H2,1-2H3,(H2,10,15)(H,11,13) |
| InChIKey | PZRYOROWQYPJRK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|