C11H21N3O2S — CID 55000877
N-(2-amino-2-sulfanylideneethyl)-N'-(2-methylpropyl)-N'-propan-2-yloxamide (PubChem CID 55000877) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2-methylpropyl)-N'-propan-2-yloxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-methylpropyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 55000877 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-methylpropyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)CN(C(=O)C(=O)NCC(N)=S)C(C)C |
| InChI | InChI=1S/C11H21N3O2S/c1-7(2)6-14(8(3)4)11(16)10(15)13-5-9(12)17/h7-8H,5-6H2,1-4H3,(H2,12,17)(H,13,15) |
| InChIKey | NUUHQWMJCNIMFG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|