C10H19N3O2S2 — CID 112659642
N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-(1-methylsulfanylbutan-2-yl)oxamide (PubChem CID 112659642) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-(1-methylsulfanylbutan-2-yl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-(1-methylsulfanylbutan-2-yl)oxamide |
|---|---|
| PubChem CID | 112659642 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-methyl-N'-(1-methylsulfanylbutan-2-yl)oxamide |
| SMILES | CCC(CSC)N(C)C(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C10H19N3O2S2/c1-4-7(6-17-3)13(2)10(15)9(14)12-5-8(11)16/h7H,4-6H2,1-3H3,(H2,11,16)(H,12,14) |
| InChIKey | XBDMWXDQPRBBIP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|