C10H22N2S2 — CID 112659869
2-[methyl(1-methylsulfanylbutan-2-yl)amino]butanethioamide (PubChem CID 112659869) has the molecular formula C10H22N2S2 and a molecular weight of 234.43 g/mol. Its IUPAC name is 2-[methyl(1-methylsulfanylbutan-2-yl)amino]butanethioamide.
| Compound Name | 2-[methyl(1-methylsulfanylbutan-2-yl)amino]butanethioamide |
|---|---|
| PubChem CID | 112659869 |
| Molecular Formula | C10H22N2S2 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-[methyl(1-methylsulfanylbutan-2-yl)amino]butanethioamide |
| SMILES | CCC(CSC)N(C)C(CC)C(N)=S |
| InChI | InChI=1S/C10H22N2S2/c1-5-8(7-14-4)12(3)9(6-2)10(11)13/h8-9H,5-7H2,1-4H3,(H2,11,13) |
| InChIKey | HDUZEJRDLACSBZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|