C12H24N2OS2 — CID 112659636
2-carbamothioyl-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)butanamide (PubChem CID 112659636) has the molecular formula C12H24N2OS2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2-carbamothioyl-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)butanamide.
| Compound Name | 2-carbamothioyl-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 112659636 |
| Molecular Formula | C12H24N2OS2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-carbamothioyl-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)butanamide |
| SMILES | CCC(CSC)N(C)C(=O)C(C)(CC)C(N)=S |
| InChI | InChI=1S/C12H24N2OS2/c1-6-9(8-17-5)14(4)11(15)12(3,7-2)10(13)16/h9H,6-8H2,1-5H3,(H2,13,16) |
| InChIKey | IHPFVXNKFANOHB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|