C8H15NO3S — CID 112663253
2-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-oxoacetic acid (PubChem CID 112663253) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-oxoacetic acid.
| Compound Name | 2-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 112663253 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-oxoacetic acid |
| SMILES | CCC(CSC)N(C)C(=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3S/c1-4-6(5-13-3)9(2)7(10)8(11)12/h6H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | YCHZSKMNYASURU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|