C11H22N2O3S — CID 112662748
2-[methyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid (PubChem CID 112662748) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[methyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 112662748 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[methyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid |
| SMILES | CCC(CSC)N(C)C(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-6-9(7-17-5)13(4)11(16)12(3)8(2)10(14)15/h8-9H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | KANSKHAVCDQPOI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |