C10H20N2O4S — CID 103955226
(2S)-3-hydroxy-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid (PubChem CID 103955226) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 103955226 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2S)-3-hydroxy-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]propanoic acid |
| SMILES | CCC(CSC)N(C)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-4-7(6-17-3)12(2)10(16)11-8(5-13)9(14)15/h7-8,13H,4-6H2,1-3H3,(H,11,16)(H,14,15)/t7?,8-/m0/s1 |
| InChIKey | GEQQKXLIBFPSBJ-MQWKRIRWSA-N |
| XLogP | 0.21 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |