C12H23N3O4S — CID 103955225
(2S)-5-amino-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-5-oxopentanoic acid (PubChem CID 103955225) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2S)-5-amino-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 103955225 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S)-5-amino-2-[[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-5-oxopentanoic acid |
| SMILES | CCC(CSC)N(C)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H23N3O4S/c1-4-8(7-20-3)15(2)12(19)14-9(11(17)18)5-6-10(13)16/h8-9H,4-7H2,1-3H3,(H2,13,16)(H,14,19)(H,17,18)/t8?,9-/m0/s1 |
| InChIKey | YWEMCQHGLXZRFN-GKAPJAKFSA-N |
| XLogP | 0.49 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |