C13H26N2O3S — CID 112662766
2-[ethyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-2-methylpropanoic acid (PubChem CID 112662766) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[ethyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 112662766 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[ethyl-[methyl(1-methylsulfanylbutan-2-yl)carbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCC(CSC)N(C)C(=O)N(CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H26N2O3S/c1-7-10(9-19-6)14(5)12(18)15(8-2)13(3,4)11(16)17/h10H,7-9H2,1-6H3,(H,16,17) |
| InChIKey | XOHFOSAEPJXAQA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |