C10H21NO3S — CID 103224864
3-methoxy-2-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid (PubChem CID 103224864) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-methoxy-2-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 103224864 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-methoxy-2-[methyl(1-methylsulfanylbutan-2-yl)amino]propanoic acid |
| SMILES | CCC(CSC)N(C)C(COC)C(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-5-8(7-15-4)11(2)9(6-14-3)10(12)13/h8-9H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | VZOQKASESYNUAB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |