C13H30N2OS — CID 103227188
3-methoxy-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)-1-N-propylpropane-1,2-diamine (PubChem CID 103227188) has the molecular formula C13H30N2OS and a molecular weight of 262.46 g/mol. Its IUPAC name is 3-methoxy-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)-1-N-propylpropane-1,2-diamine.
| Compound Name | 3-methoxy-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)-1-N-propylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103227188 |
| Molecular Formula | C13H30N2OS |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 3-methoxy-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)-1-N-propylpropane-1,2-diamine |
| SMILES | CCCNCC(COC)N(C)C(CC)CSC |
| InChI | InChI=1S/C13H30N2OS/c1-6-8-14-9-13(10-16-4)15(3)12(7-2)11-17-5/h12-14H,6-11H2,1-5H3 |
| InChIKey | RZHZSIWCFDJBEX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|