C10H17N3O2S — CID 43316466
N-(2-amino-2-sulfanylideneethyl)-N'-cyclopentyl-N'-methyloxamide (PubChem CID 43316466) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-cyclopentyl-N'-methyloxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-cyclopentyl-N'-methyloxamide |
|---|---|
| PubChem CID | 43316466 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-cyclopentyl-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)NCC(N)=S)C1CCCC1 |
| InChI | InChI=1S/C10H17N3O2S/c1-13(7-4-2-3-5-7)10(15)9(14)12-6-8(11)16/h7H,2-6H2,1H3,(H2,11,16)(H,12,14) |
| InChIKey | NNIZJYCMEHJZRD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|