C11H19N3O3S — CID 113394784
N-(2-amino-2-sulfanylideneethyl)-N'-(2-hydroxycycloheptyl)oxamide (PubChem CID 113394784) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2-hydroxycycloheptyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-hydroxycycloheptyl)oxamide |
|---|---|
| PubChem CID | 113394784 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-hydroxycycloheptyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)NC1CCCCCC1O |
| InChI | InChI=1S/C11H19N3O3S/c12-9(18)6-13-10(16)11(17)14-7-4-2-1-3-5-8(7)15/h7-8,15H,1-6H2,(H2,12,18)(H,13,16)(H,14,17) |
| InChIKey | MRDMFAAVWFKEMW-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|