About N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide
N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide (PubChem CID 108503625) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide.
Molecular Properties
| Compound Name | N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide |
| PubChem CID | 108503625 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide |
| SMILES | CCOCCCNC(=O)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C14H26N2O3/c1-3-19-11-7-10-15-13(17)14(18)16(2)12-8-5-4-6-9-12/h12H,3-11H2,1-2H3,(H,15,17) |
| InChIKey | GNQPXRFCCYPTCO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide?
The IUPAC name of N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide (CID 108503625) is N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide.
What is the SMILES notation for N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide?
The canonical SMILES for N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide is CCOCCCNC(=O)C(=O)N(C)C1CCCCC1.
What is the InChIKey of N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide?
The InChIKey is GNQPXRFCCYPTCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-3-19-11-7-10-15-13(17)14(18)16(2)12-8-5-4-6-9-12/h12H,3-11H2,1-2H3,(H,15,17).
What are the key properties of N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide?
N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide has a molecular weight of 270.37 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N-(3-ethoxypropyl)-N'-methyloxamide is sourced from PubChem (CID 108503625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).