C11H21N3O4 — CID 108505337
N'-(2-acetamidoethyl)-N-(3-ethoxypropyl)oxamide (PubChem CID 108505337) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is N'-(2-acetamidoethyl)-N-(3-ethoxypropyl)oxamide.
| Compound Name | N'-(2-acetamidoethyl)-N-(3-ethoxypropyl)oxamide |
|---|---|
| PubChem CID | 108505337 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N'-(2-acetamidoethyl)-N-(3-ethoxypropyl)oxamide |
| SMILES | CCOCCCNC(=O)C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C11H21N3O4/c1-3-18-8-4-5-13-10(16)11(17)14-7-6-12-9(2)15/h3-8H2,1-2H3,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | FCLWMQKKKNPIMJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|