About N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide
N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide (PubChem CID 108505282) has the molecular formula C12H25N3O3
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide |
| PubChem CID | 108505282 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide |
| SMILES | CCOCCCNC(=O)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-4-18-10-6-8-14-12(17)11(16)13-7-5-9-15(2)3/h4-10H2,1-3H3,(H,13,16)(H,14,17) |
| InChIKey | OOAASFPOTVCPKE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide?
The IUPAC name of N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide (CID 108505282) is N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide.
What is the SMILES notation for N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide?
The canonical SMILES for N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide is CCOCCCNC(=O)C(=O)NCCCN(C)C.
What is the InChIKey of N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide?
The InChIKey is OOAASFPOTVCPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O3/c1-4-18-10-6-8-14-12(17)11(16)13-7-5-9-15(2)3/h4-10H2,1-3H3,(H,13,16)(H,14,17).
What are the key properties of N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide?
N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide has a molecular weight of 259.35 g/mol, XLogP of -0.40, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)propyl]-N'-(3-ethoxypropyl)oxamide is sourced from PubChem (CID 108505282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).