C10H23N3O2 — CID 58817776
1-[3-(dimethylamino)propyl]-3-(3-methoxypropyl)urea (PubChem CID 58817776) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 58817776 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)NCCCN(C)C |
| InChI | InChI=1S/C10H23N3O2/c1-13(2)8-4-6-11-10(14)12-7-5-9-15-3/h4-9H2,1-3H3,(H2,11,12,14) |
| InChIKey | UHMPAGFJVQJFRW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|