C8H21N3O2 — CID 175591595
1-[3-(dimethylamino)propyl]-3-ethylurea;hydrate (PubChem CID 175591595) has the molecular formula C8H21N3O2 and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-ethylurea;hydrate.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-ethylurea;hydrate |
|---|---|
| PubChem CID | 175591595 |
| Molecular Formula | C8H21N3O2 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.16 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-ethylurea;hydrate |
| SMILES | CCNC(=O)NCCCN(C)C.O |
| InChI | InChI=1S/C8H19N3O.H2O/c1-4-9-8(12)10-6-5-7-11(2)3;/h4-7H2,1-3H3,(H2,9,10,12);1H2 |
| InChIKey | ZHQMBCSVYWKFRP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|