C8H19N3O — CID 115595346
1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]urea (PubChem CID 115595346) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]urea.
| Compound Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 115595346 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]urea |
| SMILES | CCNC(=O)NCCN(C)CC |
| InChI | InChI=1S/C8H19N3O/c1-4-9-8(12)10-6-7-11(3)5-2/h4-7H2,1-3H3,(H2,9,10,12) |
| InChIKey | KRJWSVGWAHAABL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |