C10H21N3O4 — CID 107827546
(2R)-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107827546) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2R)-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107827546 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2R)-2-[2-[ethyl(methyl)amino]ethylcarbamoylamino]-4-hydroxybutanoic acid |
| SMILES | CCN(C)CCNC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C10H21N3O4/c1-3-13(2)6-5-11-10(17)12-8(4-7-14)9(15)16/h8,14H,3-7H2,1-2H3,(H,15,16)(H2,11,12,17)/t8-/m1/s1 |
| InChIKey | ZSGGVKFXQVZHNY-MRVPVSSYSA-N |
| XLogP | -0.93 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |