C10H17N3O3S — CID 108505333
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(3-ethoxypropyl)oxamide (PubChem CID 108505333) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(3-ethoxypropyl)oxamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(3-ethoxypropyl)oxamide |
|---|---|
| PubChem CID | 108505333 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(3-ethoxypropyl)oxamide |
| SMILES | CCOCCCNC(=O)C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C10H17N3O3S/c1-2-16-6-3-4-11-8(14)9(15)13-10-12-5-7-17-10/h2-7H2,1H3,(H,11,14)(H,12,13,15) |
| InChIKey | HPKJAZLMTVBWRT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|