C14H17N3O3S — CID 108505304
[4-[[2-(3-ethoxypropylamino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108505304) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is [4-[[2-(3-ethoxypropylamino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(3-ethoxypropylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108505304 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [4-[[2-(3-ethoxypropylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | CCOCCCNC(=O)C(=O)Nc1ccc(SC#N)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-2-20-9-3-8-16-13(18)14(19)17-11-4-6-12(7-5-11)21-10-15/h4-7H,2-3,8-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VQDHAVWWQYIPBW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|