C16H13N3O2S — CID 108508936
[4-[[2-(benzylamino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108508936) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is [4-[[2-(benzylamino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(benzylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108508936 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | [4-[[2-(benzylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H13N3O2S/c17-11-22-14-8-6-13(7-9-14)19-16(21)15(20)18-10-12-4-2-1-3-5-12/h1-9H,10H2,(H,18,20)(H,19,21) |
| InChIKey | LOYRGMRRKYMQHM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|