C17H13N3O4S — CID 108508572
[4-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108508572) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is [4-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108508572 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | [4-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H13N3O4S/c18-9-25-13-4-2-12(3-5-13)20-17(22)16(21)19-8-11-1-6-14-15(7-11)24-10-23-14/h1-7H,8,10H2,(H,19,21)(H,20,22) |
| InChIKey | IZFUJMMFXUCPSQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|