C17H13N3O4 — CID 108508533
N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-cyanophenyl)oxamide (PubChem CID 108508533) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-cyanophenyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-cyanophenyl)oxamide |
|---|---|
| PubChem CID | 108508533 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-cyanophenyl)oxamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H13N3O4/c18-8-11-1-4-13(5-2-11)20-17(22)16(21)19-9-12-3-6-14-15(7-12)24-10-23-14/h1-7H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | VVIMVOYZDVVEFK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|