C20H15N5O3 — CID 109258244
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanoanilino)pyrimidine-5-carboxamide (PubChem CID 109258244) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanoanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanoanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258244 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-cyanoanilino)pyrimidine-5-carboxamide |
| SMILES | N#Cc1ccc(Nc2ncc(C(=O)NCc3ccc4c(c3)OCO4)cn2)cc1 |
| InChI | InChI=1S/C20H15N5O3/c21-8-13-1-4-16(5-2-13)25-20-23-10-15(11-24-20)19(26)22-9-14-3-6-17-18(7-14)28-12-27-17/h1-7,10-11H,9,12H2,(H,22,26)(H,23,24,25) |
| InChIKey | HPYUDJMATFQVNZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |