C19H15FN4O3 — CID 109258219
N-(1,3-benzodioxol-5-ylmethyl)-2-(2-fluoroanilino)pyrimidine-5-carboxamide (PubChem CID 109258219) has the molecular formula C19H15FN4O3 and a molecular weight of 366.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(2-fluoroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-fluoroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258219 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-fluoroanilino)pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cnc(Nc2ccccc2F)nc1 |
| InChI | InChI=1S/C19H15FN4O3/c20-14-3-1-2-4-15(14)24-19-22-9-13(10-23-19)18(25)21-8-12-5-6-16-17(7-12)27-11-26-16/h1-7,9-10H,8,11H2,(H,21,25)(H,22,23,24) |
| InChIKey | VESRNGXEPLNLNH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |