About N-[(4-cyanophenyl)methyl]-N'-phenyloxamide
N-[(4-cyanophenyl)methyl]-N'-phenyloxamide (PubChem CID 166188116) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-[(4-cyanophenyl)methyl]-N'-phenyloxamide |
| PubChem CID | 166188116 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N'-phenyloxamide |
| SMILES | N#Cc1ccc(CNC(=O)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H13N3O2/c17-10-12-6-8-13(9-7-12)11-18-15(20)16(21)19-14-4-2-1-3-5-14/h1-9H,11H2,(H,18,20)(H,19,21) |
| InChIKey | INCNYLFPFXXTGT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-cyanophenyl)methyl]-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-cyanophenyl)methyl]-N'-phenyloxamide?
The IUPAC name of N-[(4-cyanophenyl)methyl]-N'-phenyloxamide (CID 166188116) is N-[(4-cyanophenyl)methyl]-N'-phenyloxamide.
What is the SMILES notation for N-[(4-cyanophenyl)methyl]-N'-phenyloxamide?
The canonical SMILES for N-[(4-cyanophenyl)methyl]-N'-phenyloxamide is N#Cc1ccc(CNC(=O)C(=O)Nc2ccccc2)cc1.
What is the InChIKey of N-[(4-cyanophenyl)methyl]-N'-phenyloxamide?
The InChIKey is INCNYLFPFXXTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c17-10-12-6-8-13(9-7-12)11-18-15(20)16(21)19-14-4-2-1-3-5-14/h1-9H,11H2,(H,18,20)(H,19,21).
What are the key properties of N-[(4-cyanophenyl)methyl]-N'-phenyloxamide?
N-[(4-cyanophenyl)methyl]-N'-phenyloxamide has a molecular weight of 279.30 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-cyanophenyl)methyl]-N'-phenyloxamide is sourced from PubChem (CID 166188116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).