C17H14N4O3S — CID 108526495
[4-[[2-(3-acetamidoanilino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108526495) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is [4-[[2-(3-acetamidoanilino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(3-acetamidoanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108526495 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [4-[[2-(3-acetamidoanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)Nc2ccc(SC#N)cc2)c1 |
| InChI | InChI=1S/C17H14N4O3S/c1-11(22)19-13-3-2-4-14(9-13)21-17(24)16(23)20-12-5-7-15(8-6-12)25-10-18/h2-9H,1H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | QVVVDAMPEZQMTD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|