C12H19N3O2 — CID 43469047
1-(4-aminophenyl)-3-(3-ethoxypropyl)urea (PubChem CID 43469047) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(3-ethoxypropyl)urea.
| Compound Name | 1-(4-aminophenyl)-3-(3-ethoxypropyl)urea |
|---|---|
| PubChem CID | 43469047 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-(4-aminophenyl)-3-(3-ethoxypropyl)urea |
| SMILES | CCOCCCNC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C12H19N3O2/c1-2-17-9-3-8-14-12(16)15-11-6-4-10(13)5-7-11/h4-7H,2-3,8-9,13H2,1H3,(H2,14,15,16) |
| InChIKey | VIMURWYVJDWKJB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|