C19H23N3O3 — CID 108505286
N'-(4-aminophenyl)-N-(3-ethoxypropyl)-N'-phenyloxamide (PubChem CID 108505286) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N-(3-ethoxypropyl)-N'-phenyloxamide.
| Compound Name | N'-(4-aminophenyl)-N-(3-ethoxypropyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 108505286 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N'-(4-aminophenyl)-N-(3-ethoxypropyl)-N'-phenyloxamide |
| SMILES | CCOCCCNC(=O)C(=O)N(c1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-25-14-6-13-21-18(23)19(24)22(16-7-4-3-5-8-16)17-11-9-15(20)10-12-17/h3-5,7-12H,2,6,13-14,20H2,1H3,(H,21,23) |
| InChIKey | HLGLVEDZSZSQSL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|