C15H20N2O5 — CID 7515099
[2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] benzoate (PubChem CID 7515099) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] benzoate.
| Compound Name | [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 7515099 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [2-(3-ethoxypropylcarbamoylamino)-2-oxoethyl] benzoate |
| SMILES | CCOCCCNC(=O)NC(=O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O5/c1-2-21-10-6-9-16-15(20)17-13(18)11-22-14(19)12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3,(H2,16,17,18,20) |
| InChIKey | LTQIANXITLTWLV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|