C19H18N2O5 — CID 2621703
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 2621703) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 2621703 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5/c1-2-20-19(25)21-16(22)12-26-18(24)15-11-7-6-10-14(15)17(23)13-8-4-3-5-9-13/h3-11H,2,12H2,1H3,(H2,20,21,22,25) |
| InChIKey | ZRJIKAOMEILSFI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |