C15H21N3O4 — CID 7670898
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 7670898) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7670898 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)NC(=O)NCC(C)C |
| InChI | InChI=1S/C15H21N3O4/c1-10(2)8-17-15(21)18-13(19)9-22-14(20)11-6-4-5-7-12(11)16-3/h4-7,10,16H,8-9H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | WWJBYVJOTDRYLW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |