C21H24N2O5 — CID 2605824
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 2605824) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 2605824 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O5/c1-15(2)12-22-21(26)23-19(24)14-28-20(25)17-10-6-7-11-18(17)27-13-16-8-4-3-5-9-16/h3-11,15H,12-14H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | QKCINRAKZDHPHX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |