C19H22N2O5 — CID 2641341
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 3-methoxynaphthalene-2-carboxylate (PubChem CID 2641341) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 3-methoxynaphthalene-2-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 3-methoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2641341 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 3-methoxynaphthalene-2-carboxylate |
| SMILES | COc1cc2ccccc2cc1C(=O)OCC(=O)NC(=O)NCC(C)C |
| InChI | InChI=1S/C19H22N2O5/c1-12(2)10-20-19(24)21-17(22)11-26-18(23)15-8-13-6-4-5-7-14(13)9-16(15)25-3/h4-9,12H,10-11H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | ASUZDAOPWLTYDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |