C17H25N3O4 — CID 108506572
N'-acetyl-N'-(3-aminophenyl)-N-(3-butoxypropyl)oxamide (PubChem CID 108506572) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-(3-butoxypropyl)oxamide.
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-(3-butoxypropyl)oxamide |
|---|---|
| PubChem CID | 108506572 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-(3-butoxypropyl)oxamide |
| SMILES | CCCCOCCCNC(=O)C(=O)N(C(C)=O)c1cccc(N)c1 |
| InChI | InChI=1S/C17H25N3O4/c1-3-4-10-24-11-6-9-19-16(22)17(23)20(13(2)21)15-8-5-7-14(18)12-15/h5,7-8,12H,3-4,6,9-11,18H2,1-2H3,(H,19,22) |
| InChIKey | KKLDDGYXLPKZRR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|