C18H20N4O5S — CID 108526549
N'-acetyl-N'-(3-aminophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide (PubChem CID 108526549) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide.
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108526549 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]oxamide |
| SMILES | CC(=O)N(C(=O)C(=O)NCCc1ccc(S(N)(=O)=O)cc1)c1cccc(N)c1 |
| InChI | InChI=1S/C18H20N4O5S/c1-12(23)22(15-4-2-3-14(19)11-15)18(25)17(24)21-10-9-13-5-7-16(8-6-13)28(20,26)27/h2-8,11H,9-10,19H2,1H3,(H,21,24)(H2,20,26,27) |
| InChIKey | ZFYSUEHRHPJLPC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|